C22H29F3N2OS2 — CID 164587641
ethane;ethene;N-(4-methylsulfinylphenyl)-4-[(2E,4Z)-8,8,8-trifluoroocta-2,4-dien-3-yl]-1,3-thiazol-2-amine (PubChem CID 164587641) has the molecular formula C22H29F3N2OS2 and a molecular weight of 458.62 g/mol. Its IUPAC name is ethane;ethene;N-(4-methylsulfinylphenyl)-4-[(2E,4Z)-8,8,8-trifluoroocta-2,4-dien-3-yl]-1,3-thiazol-2-amine.
| Compound Name | ethane;ethene;N-(4-methylsulfinylphenyl)-4-[(2E,4Z)-8,8,8-trifluoroocta-2,4-dien-3-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 164587641 |
| Molecular Formula | C22H29F3N2OS2 |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | ethane;ethene;N-(4-methylsulfinylphenyl)-4-[(2E,4Z)-8,8,8-trifluoroocta-2,4-dien-3-yl]-1,3-thiazol-2-amine |
| SMILES | C/C=C(\C=C/CCC(F)(F)F)c1csc(Nc2ccc(S(C)=O)cc2)n1.C=C.CC |
| InChI | InChI=1S/C18H19F3N2OS2.C2H6.C2H4/c1-3-13(6-4-5-11-18(19,20)21)16-12-25-17(23-16)22-14-7-9-15(10-8-14)26(2)24;2*1-2/h3-4,6-10,12H,5,11H2,1-2H3,(H,22,23);1-2H3;1-2H2/b6-4-,13-3+;; |
| InChIKey | IUASFZKEVFAHQD-TVKGYITQSA-N |
| XLogP | 7.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|