About methyl (2S)-2-amino-3-[4-(6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl)phenyl]propanoate
methyl (2S)-2-amino-3-[4-(6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl)phenyl]propanoate (PubChem CID 164588529) has the molecular formula C20H19FN2O3
and a molecular weight of 354.38 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-[4-(6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl)phenyl]propanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-amino-3-[4-(6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl)phenyl]propanoate |
| PubChem CID | 164588529 |
| Molecular Formula | C20H19FN2O3 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | methyl (2S)-2-amino-3-[4-(6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl)phenyl]propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1ccc(N2C(=O)C3(CC3)c3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C20H19FN2O3/c1-26-18(24)16(22)10-12-2-5-14(6-3-12)23-17-11-13(21)4-7-15(17)20(8-9-20)19(23)25/h2-7,11,16H,8-10,22H2,1H3/t16-/m0/s1 |
| InChIKey | GORBHIHXRMGKFW-INIZCTEOSA-N |
| XLogP | 2.58 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2S)-2-amino-3-[4-(6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-amino-3-[4-(6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl)phenyl]propanoate?
The IUPAC name of methyl (2S)-2-amino-3-[4-(6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl)phenyl]propanoate (CID 164588529) is methyl (2S)-2-amino-3-[4-(6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl)phenyl]propanoate.
What is the SMILES notation for methyl (2S)-2-amino-3-[4-(6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl)phenyl]propanoate?
The canonical SMILES for methyl (2S)-2-amino-3-[4-(6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl)phenyl]propanoate is COC(=O)[C@@H](N)Cc1ccc(N2C(=O)C3(CC3)c3ccc(F)cc32)cc1.
What is the InChIKey of methyl (2S)-2-amino-3-[4-(6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl)phenyl]propanoate?
The InChIKey is GORBHIHXRMGKFW-INIZCTEOSA-N. The full InChI is InChI=1S/C20H19FN2O3/c1-26-18(24)16(22)10-12-2-5-14(6-3-12)23-17-11-13(21)4-7-15(17)20(8-9-20)19(23)25/h2-7,11,16H,8-10,22H2,1H3/t16-/m0/s1.
What are the key properties of methyl (2S)-2-amino-3-[4-(6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl)phenyl]propanoate?
methyl (2S)-2-amino-3-[4-(6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl)phenyl]propanoate has a molecular weight of 354.38 g/mol, XLogP of 2.58, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-amino-3-[4-(6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl)phenyl]propanoate is sourced from PubChem (CID 164588529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).