C15H9F6N3O3 — CID 164588993
6-(3-fluoro-1-oxidopyridin-1-ium-2-yl)-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one (PubChem CID 164588993) has the molecular formula C15H9F6N3O3 and a molecular weight of 393.24 g/mol. Its IUPAC name is 6-(3-fluoro-1-oxidopyridin-1-ium-2-yl)-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one.
| Compound Name | 6-(3-fluoro-1-oxidopyridin-1-ium-2-yl)-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 164588993 |
| Molecular Formula | C15H9F6N3O3 |
| Molecular Weight | 393.24 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 6-(3-fluoro-1-oxidopyridin-1-ium-2-yl)-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one |
| SMILES | O=C1OCc2cc(-c3c(F)ccc[n+]3[O-])ncc2N1CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H9F6N3O3/c16-9-2-1-3-24(26)12(9)10-4-8-6-27-13(25)23(11(8)5-22-10)7-14(17,18)15(19,20)21/h1-5H,6-7H2 |
| InChIKey | KVRSRBUMGDIMSE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|