About 2-tert-butyl-4-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene
2-tert-butyl-4-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene (PubChem CID 164591697) has the molecular formula C16H23N
and a molecular weight of 229.37 g/mol. Its IUPAC name is 2-tert-butyl-4-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene.
Molecular Properties
| Compound Name | 2-tert-butyl-4-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene |
| PubChem CID | 164591697 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 2-tert-butyl-4-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene |
| SMILES | C=C.C=C/C(=C\C)c1ccnc(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H19N.C2H4/c1-6-11(7-2)12-8-9-15-13(10-12)14(3,4)5;1-2/h6-10H,1H2,2-5H3;1-2H2/b11-7+; |
| InChIKey | JEPSNOSOTSTYLM-RVDQCCQOSA-N |
| XLogP | 4.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-4-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene?
The IUPAC name of 2-tert-butyl-4-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene (CID 164591697) is 2-tert-butyl-4-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene.
What is the SMILES notation for 2-tert-butyl-4-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene?
The canonical SMILES for 2-tert-butyl-4-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene is C=C.C=C/C(=C\C)c1ccnc(C(C)(C)C)c1.
What is the InChIKey of 2-tert-butyl-4-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene?
The InChIKey is JEPSNOSOTSTYLM-RVDQCCQOSA-N. The full InChI is InChI=1S/C14H19N.C2H4/c1-6-11(7-2)12-8-9-15-13(10-12)14(3,4)5;1-2/h6-10H,1H2,2-5H3;1-2H2/b11-7+;.
What are the key properties of 2-tert-butyl-4-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene?
2-tert-butyl-4-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene has a molecular weight of 229.37 g/mol, XLogP of 4.77, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-[(3E)-penta-1,3-dien-3-yl]pyridine;ethene is sourced from PubChem (CID 164591697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).