C11H11F2N — CID 164591709
2-fluoro-5-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine (PubChem CID 164591709) has the molecular formula C11H11F2N and a molecular weight of 195.21 g/mol. Its IUPAC name is 2-fluoro-5-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine.
| Compound Name | 2-fluoro-5-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine |
|---|---|
| PubChem CID | 164591709 |
| Molecular Formula | C11H11F2N |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 2-fluoro-5-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]-3,4-dihydropyridine |
| SMILES | C=C/C=C(/F)C(=C)C1=CN=C(F)CC1 |
| InChI | InChI=1S/C11H11F2N/c1-3-4-10(12)8(2)9-5-6-11(13)14-7-9/h3-4,7H,1-2,5-6H2/b10-4+ |
| InChIKey | KOTCSADOCPJIER-ONNFQVAWSA-N |
| XLogP | 3.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|