C48H53N5O2 — CID 164592358
N-[6-[3-[[3-(4-hydroxycyclohexyl)-4-imino-5,6-diphenylpyrrolo[2,3-d]pyrimidin-7-yl]methyl]phenyl]hex-5-ynyl]-2-(2-tricyclo[3.3.1.03,7]nonanyl)acetamide (PubChem CID 164592358) has the molecular formula C48H53N5O2 and a molecular weight of 731.99 g/mol. Its IUPAC name is N-[6-[3-[[3-(4-hydroxycyclohexyl)-4-imino-5,6-diphenylpyrrolo[2,3-d]pyrimidin-7-yl]methyl]phenyl]hex-5-ynyl]-2-(2-tricyclo[3.3.1.03,7]nonanyl)acetamide.
| Compound Name | N-[6-[3-[[3-(4-hydroxycyclohexyl)-4-imino-5,6-diphenylpyrrolo[2,3-d]pyrimidin-7-yl]methyl]phenyl]hex-5-ynyl]-2-(2-tricyclo[3.3.1.03,7]nonanyl)acetamide |
|---|---|
| PubChem CID | 164592358 |
| Molecular Formula | C48H53N5O2 |
| Molecular Weight | 731.99 g/mol |
| Exact Mass | 731.42 |
| IUPAC Name | N-[6-[3-[[3-(4-hydroxycyclohexyl)-4-imino-5,6-diphenylpyrrolo[2,3-d]pyrimidin-7-yl]methyl]phenyl]hex-5-ynyl]-2-(2-tricyclo[3.3.1.03,7]nonanyl)acetamide |
| SMILES | [H]/N=c1/c2c(-c3ccccc3)c(-c3ccccc3)n(Cc3cccc(C#CCCCCNC(=O)CC4C5CC6CC(C5)C4C6)c3)c2ncn1C1CCC(O)CC1 |
| InChI | InChI=1S/C48H53N5O2/c49-47-45-44(35-15-6-3-7-16-35)46(36-17-8-4-9-18-36)52(48(45)51-31-53(47)39-19-21-40(54)22-20-39)30-33-14-11-13-32(24-33)12-5-1-2-10-23-50-43(55)29-42-38-26-34-25-37(28-38)41(42)27-34/h3-4,6-9,11,13-18,24,31,34,37-42,49,54H,1-2,10,19-23,25-30H2,(H,50,55)/b49-47- |
| InChIKey | TVWQKXYPSNTHHB-RYMJNUNPSA-N |
| XLogP | 8.89 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.99 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|