C15H16FN4P — CID 164593640
4-fluoro-3-[2-(1-methylpyrazolo[4,5-b]pyridin-6-yl)ethyl]-2-phosphanylaniline (PubChem CID 164593640) has the molecular formula C15H16FN4P and a molecular weight of 302.29 g/mol. Its IUPAC name is 4-fluoro-3-[2-(1-methylpyrazolo[4,5-b]pyridin-6-yl)ethyl]-2-phosphanylaniline.
| Compound Name | 4-fluoro-3-[2-(1-methylpyrazolo[4,5-b]pyridin-6-yl)ethyl]-2-phosphanylaniline |
|---|---|
| PubChem CID | 164593640 |
| Molecular Formula | C15H16FN4P |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 4-fluoro-3-[2-(1-methylpyrazolo[4,5-b]pyridin-6-yl)ethyl]-2-phosphanylaniline |
| SMILES | Cn1ncc2ncc(CCc3c(F)ccc(N)c3P)cc21 |
| InChI | InChI=1S/C15H16FN4P/c1-20-14-6-9(7-18-13(14)8-19-20)2-3-10-11(16)4-5-12(17)15(10)21/h4-8H,2-3,17,21H2,1H3 |
| InChIKey | GFQYOGQYOXIDJT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|