C32H40F2N7O2S+ — CID 164593726
(5-cyano-2-methoxy-3-pyridinyl)-[3-[(2Z)-2-ethylidene-1-[(Z)-1-(1H-imidazol-2-yl)pent-1-enyl]-4-pyridinyl]-2,4-difluoroanilino]-hydroxy-sulfanylazanium;ethane (PubChem CID 164593726) has the molecular formula C32H40F2N7O2S+ and a molecular weight of 624.78 g/mol. Its IUPAC name is (5-cyano-2-methoxy-3-pyridinyl)-[3-[(2Z)-2-ethylidene-1-[(Z)-1-(1H-imidazol-2-yl)pent-1-enyl]-4-pyridinyl]-2,4-difluoroanilino]-hydroxy-sulfanylazanium;ethane.
| Compound Name | (5-cyano-2-methoxy-3-pyridinyl)-[3-[(2Z)-2-ethylidene-1-[(Z)-1-(1H-imidazol-2-yl)pent-1-enyl]-4-pyridinyl]-2,4-difluoroanilino]-hydroxy-sulfanylazanium;ethane |
|---|---|
| PubChem CID | 164593726 |
| Molecular Formula | C32H40F2N7O2S+ |
| Molecular Weight | 624.78 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | (5-cyano-2-methoxy-3-pyridinyl)-[3-[(2Z)-2-ethylidene-1-[(Z)-1-(1H-imidazol-2-yl)pent-1-enyl]-4-pyridinyl]-2,4-difluoroanilino]-hydroxy-sulfanylazanium;ethane |
| SMILES | C/C=C1/C=C(c2c(F)ccc(N[N+](O)(S)c3cc(C#N)cnc3OC)c2F)C=CN1/C(=C\CCC)c1ncc[nH]1.CC.CC |
| InChI | InChI=1S/C28H28F2N7O2S.2C2H6/c1-4-6-7-23(27-32-11-12-33-27)36-13-10-19(15-20(36)5-2)25-21(29)8-9-22(26(25)30)35-37(38,40)24-14-18(16-31)17-34-28(24)39-3;2*1-2/h5,7-15,17,35,38,40H,4,6H2,1-3H3,(H,32,33);2*1-2H3/q+1;;/b20-5-,23-7-;; |
| InChIKey | LAGRGPXOGQKFEF-POSSNSFGSA-N |
| XLogP | 8.54 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.78 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|