C29H52 — CID 164594979
2,3-bis(7,7-dimethyloctyl)-1,4,5-trimethylbenzene (PubChem CID 164594979) has the molecular formula C29H52 and a molecular weight of 400.74 g/mol. Its IUPAC name is 2,3-bis(7,7-dimethyloctyl)-1,4,5-trimethylbenzene.
| Compound Name | 2,3-bis(7,7-dimethyloctyl)-1,4,5-trimethylbenzene |
|---|---|
| PubChem CID | 164594979 |
| Molecular Formula | C29H52 |
| Molecular Weight | 400.74 g/mol |
| Exact Mass | 400.41 |
| IUPAC Name | 2,3-bis(7,7-dimethyloctyl)-1,4,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(CCCCCCC(C)(C)C)c(CCCCCCC(C)(C)C)c1C |
| InChI | InChI=1S/C29H52/c1-23-22-24(2)26(18-14-10-12-16-20-28(4,5)6)27(25(23)3)19-15-11-13-17-21-29(7,8)9/h22H,10-21H2,1-9H3 |
| InChIKey | VQPSHHJFJNOKIR-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.74 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|