About (2R)-2,4-dihydroxy-3,3-dimethyl-1-[1-methyl-5-(pyridine-3-carbonyl)pyrrol-2-yl]butan-1-one
(2R)-2,4-dihydroxy-3,3-dimethyl-1-[1-methyl-5-(pyridine-3-carbonyl)pyrrol-2-yl]butan-1-one (PubChem CID 164595777) has the molecular formula C17H20N2O4
and a molecular weight of 316.36 g/mol. Its IUPAC name is (2R)-2,4-dihydroxy-3,3-dimethyl-1-[1-methyl-5-(pyridine-3-carbonyl)pyrrol-2-yl]butan-1-one.
Molecular Properties
| Compound Name | (2R)-2,4-dihydroxy-3,3-dimethyl-1-[1-methyl-5-(pyridine-3-carbonyl)pyrrol-2-yl]butan-1-one |
| PubChem CID | 164595777 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (2R)-2,4-dihydroxy-3,3-dimethyl-1-[1-methyl-5-(pyridine-3-carbonyl)pyrrol-2-yl]butan-1-one |
| SMILES | Cn1c(C(=O)c2cccnc2)ccc1C(=O)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C17H20N2O4/c1-17(2,10-20)16(23)15(22)13-7-6-12(19(13)3)14(21)11-5-4-8-18-9-11/h4-9,16,20,23H,10H2,1-3H3/t16-/m0/s1 |
| InChIKey | YQEKAFPJLONUIE-INIZCTEOSA-N |
| XLogP | 1.21 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2R)-2,4-dihydroxy-3,3-dimethyl-1-[1-methyl-5-(pyridine-3-carbonyl)pyrrol-2-yl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,4-dihydroxy-3,3-dimethyl-1-[1-methyl-5-(pyridine-3-carbonyl)pyrrol-2-yl]butan-1-one?
The IUPAC name of (2R)-2,4-dihydroxy-3,3-dimethyl-1-[1-methyl-5-(pyridine-3-carbonyl)pyrrol-2-yl]butan-1-one (CID 164595777) is (2R)-2,4-dihydroxy-3,3-dimethyl-1-[1-methyl-5-(pyridine-3-carbonyl)pyrrol-2-yl]butan-1-one.
What is the SMILES notation for (2R)-2,4-dihydroxy-3,3-dimethyl-1-[1-methyl-5-(pyridine-3-carbonyl)pyrrol-2-yl]butan-1-one?
The canonical SMILES for (2R)-2,4-dihydroxy-3,3-dimethyl-1-[1-methyl-5-(pyridine-3-carbonyl)pyrrol-2-yl]butan-1-one is Cn1c(C(=O)c2cccnc2)ccc1C(=O)[C@H](O)C(C)(C)CO.
What is the InChIKey of (2R)-2,4-dihydroxy-3,3-dimethyl-1-[1-methyl-5-(pyridine-3-carbonyl)pyrrol-2-yl]butan-1-one?
The InChIKey is YQEKAFPJLONUIE-INIZCTEOSA-N. The full InChI is InChI=1S/C17H20N2O4/c1-17(2,10-20)16(23)15(22)13-7-6-12(19(13)3)14(21)11-5-4-8-18-9-11/h4-9,16,20,23H,10H2,1-3H3/t16-/m0/s1.
What are the key properties of (2R)-2,4-dihydroxy-3,3-dimethyl-1-[1-methyl-5-(pyridine-3-carbonyl)pyrrol-2-yl]butan-1-one?
(2R)-2,4-dihydroxy-3,3-dimethyl-1-[1-methyl-5-(pyridine-3-carbonyl)pyrrol-2-yl]butan-1-one has a molecular weight of 316.36 g/mol, XLogP of 1.21, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,4-dihydroxy-3,3-dimethyl-1-[1-methyl-5-(pyridine-3-carbonyl)pyrrol-2-yl]butan-1-one is sourced from PubChem (CID 164595777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).