About N-ethyl-4-pyrazol-1-yl-1,3,5-triazin-2-amine
N-ethyl-4-pyrazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 164595890) has the molecular formula C8H10N6
and a molecular weight of 190.21 g/mol. Its IUPAC name is N-ethyl-4-pyrazol-1-yl-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | N-ethyl-4-pyrazol-1-yl-1,3,5-triazin-2-amine |
| PubChem CID | 164595890 |
| Molecular Formula | C8H10N6 |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | N-ethyl-4-pyrazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | CCNc1ncnc(-n2cccn2)n1 |
| InChI | InChI=1S/C8H10N6/c1-2-9-7-10-6-11-8(13-7)14-5-3-4-12-14/h3-6H,2H2,1H3,(H,9,10,11,13) |
| InChIKey | IKBWFUQTGHJJSN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-ethyl-4-pyrazol-1-yl-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4-pyrazol-1-yl-1,3,5-triazin-2-amine?
The IUPAC name of N-ethyl-4-pyrazol-1-yl-1,3,5-triazin-2-amine (CID 164595890) is N-ethyl-4-pyrazol-1-yl-1,3,5-triazin-2-amine.
What is the SMILES notation for N-ethyl-4-pyrazol-1-yl-1,3,5-triazin-2-amine?
The canonical SMILES for N-ethyl-4-pyrazol-1-yl-1,3,5-triazin-2-amine is CCNc1ncnc(-n2cccn2)n1.
What is the InChIKey of N-ethyl-4-pyrazol-1-yl-1,3,5-triazin-2-amine?
The InChIKey is IKBWFUQTGHJJSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N6/c1-2-9-7-10-6-11-8(13-7)14-5-3-4-12-14/h3-6H,2H2,1H3,(H,9,10,11,13).
What are the key properties of N-ethyl-4-pyrazol-1-yl-1,3,5-triazin-2-amine?
N-ethyl-4-pyrazol-1-yl-1,3,5-triazin-2-amine has a molecular weight of 190.21 g/mol, XLogP of 0.49, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4-pyrazol-1-yl-1,3,5-triazin-2-amine is sourced from PubChem (CID 164595890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).