About (3E)-3-ethylidene-N-methylimidazo[1,2-a]pyridin-2-imine
(3E)-3-ethylidene-N-methylimidazo[1,2-a]pyridin-2-imine (PubChem CID 164596143) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is (3E)-3-ethylidene-N-methylimidazo[1,2-a]pyridin-2-imine.
Molecular Properties
| Compound Name | (3E)-3-ethylidene-N-methylimidazo[1,2-a]pyridin-2-imine |
| PubChem CID | 164596143 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | (3E)-3-ethylidene-N-methylimidazo[1,2-a]pyridin-2-imine |
| SMILES | C/C=C1C(=N\C)\N=C2C=CC=CN2\1 |
| InChI | InChI=1S/C10H11N3/c1-3-8-10(11-2)12-9-6-4-5-7-13(8)9/h3-7H,1-2H3/b8-3+,11-10- |
| InChIKey | UHBPSZURVNHBDP-IASJICLJSA-N |
| XLogP | 1.72 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-ethylidene-N-methylimidazo[1,2-a]pyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-ethylidene-N-methylimidazo[1,2-a]pyridin-2-imine?
The IUPAC name of (3E)-3-ethylidene-N-methylimidazo[1,2-a]pyridin-2-imine (CID 164596143) is (3E)-3-ethylidene-N-methylimidazo[1,2-a]pyridin-2-imine.
What is the SMILES notation for (3E)-3-ethylidene-N-methylimidazo[1,2-a]pyridin-2-imine?
The canonical SMILES for (3E)-3-ethylidene-N-methylimidazo[1,2-a]pyridin-2-imine is C/C=C1C(=N\C)\N=C2C=CC=CN2\1.
What is the InChIKey of (3E)-3-ethylidene-N-methylimidazo[1,2-a]pyridin-2-imine?
The InChIKey is UHBPSZURVNHBDP-IASJICLJSA-N. The full InChI is InChI=1S/C10H11N3/c1-3-8-10(11-2)12-9-6-4-5-7-13(8)9/h3-7H,1-2H3/b8-3+,11-10-.
What are the key properties of (3E)-3-ethylidene-N-methylimidazo[1,2-a]pyridin-2-imine?
(3E)-3-ethylidene-N-methylimidazo[1,2-a]pyridin-2-imine has a molecular weight of 173.22 g/mol, XLogP of 1.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-ethylidene-N-methylimidazo[1,2-a]pyridin-2-imine is sourced from PubChem (CID 164596143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).