C35H48N6O4 — CID 164596741
8-[bis[(4-methoxyphenyl)methyl]amino]-6-butoxy-3-(5-pyrrolidin-1-ylpentyl)-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one (PubChem CID 164596741) has the molecular formula C35H48N6O4 and a molecular weight of 616.81 g/mol. Its IUPAC name is 8-[bis[(4-methoxyphenyl)methyl]amino]-6-butoxy-3-(5-pyrrolidin-1-ylpentyl)-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one.
| Compound Name | 8-[bis[(4-methoxyphenyl)methyl]amino]-6-butoxy-3-(5-pyrrolidin-1-ylpentyl)-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 164596741 |
| Molecular Formula | C35H48N6O4 |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.37 |
| IUPAC Name | 8-[bis[(4-methoxyphenyl)methyl]amino]-6-butoxy-3-(5-pyrrolidin-1-ylpentyl)-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one |
| SMILES | CCCCOc1nc2c(c(N(Cc3ccc(OC)cc3)Cc3ccc(OC)cc3)n1)NC(=O)N(CCCCCN1CCCC1)C2 |
| InChI | InChI=1S/C35H48N6O4/c1-4-5-23-45-34-36-31-26-40(22-8-6-7-19-39-20-9-10-21-39)35(42)37-32(31)33(38-34)41(24-27-11-15-29(43-2)16-12-27)25-28-13-17-30(44-3)18-14-28/h11-18H,4-10,19-26H2,1-3H3,(H,37,42) |
| InChIKey | DDJBHXPCJSCCHN-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|