C23H23BrClFN4O4 — CID 164596905
tert-butyl (4R,7R)-17-bromo-18-chloro-16-fluoro-4-methyl-8-(oxomethylidene)-12-oxa-2,5,9,14-tetrazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(21),13,15,17,19-pentaene-5-carboxylate (PubChem CID 164596905) has the molecular formula C23H23BrClFN4O4 and a molecular weight of 553.82 g/mol. Its IUPAC name is tert-butyl (4R,7R)-17-bromo-18-chloro-16-fluoro-4-methyl-8-(oxomethylidene)-12-oxa-2,5,9,14-tetrazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(21),13,15,17,19-pentaene-5-carboxylate.
| Compound Name | tert-butyl (4R,7R)-17-bromo-18-chloro-16-fluoro-4-methyl-8-(oxomethylidene)-12-oxa-2,5,9,14-tetrazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(21),13,15,17,19-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 164596905 |
| Molecular Formula | C23H23BrClFN4O4 |
| Molecular Weight | 553.82 g/mol |
| Exact Mass | 552.06 |
| IUPAC Name | tert-butyl (4R,7R)-17-bromo-18-chloro-16-fluoro-4-methyl-8-(oxomethylidene)-12-oxa-2,5,9,14-tetrazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(21),13,15,17,19-pentaene-5-carboxylate |
| SMILES | C[C@@H]1CN2c3c4c(nc5c(F)c(Br)c(Cl)cc35)OCCN4C(=C=O)[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H23BrClFN4O4/c1-11-8-30-14(9-29(11)22(32)34-23(2,3)4)15(10-31)28-5-6-33-21-20(28)19(30)12-7-13(25)16(24)17(26)18(12)27-21/h7,11,14H,5-6,8-9H2,1-4H3/t11-,14-/m1/s1 |
| InChIKey | BAPKBJTZHKWFMN-BXUZGUMPSA-N |
| XLogP | 4.53 |
| TPSA | 75.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.82 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|