C21H25FO6S3 — CID 164597214
2-[2-[2-(3-fluoro-4-propyl-2-sulfanylidenechromen-6-yl)sulfanylethoxy]ethylsulfonyl]ethyl prop-2-enoate (PubChem CID 164597214) has the molecular formula C21H25FO6S3 and a molecular weight of 488.62 g/mol. Its IUPAC name is 2-[2-[2-(3-fluoro-4-propyl-2-sulfanylidenechromen-6-yl)sulfanylethoxy]ethylsulfonyl]ethyl prop-2-enoate.
| Compound Name | 2-[2-[2-(3-fluoro-4-propyl-2-sulfanylidenechromen-6-yl)sulfanylethoxy]ethylsulfonyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 164597214 |
| Molecular Formula | C21H25FO6S3 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 2-[2-[2-(3-fluoro-4-propyl-2-sulfanylidenechromen-6-yl)sulfanylethoxy]ethylsulfonyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCS(=O)(=O)CCOCCSc1ccc2oc(=S)c(F)c(CCC)c2c1 |
| InChI | InChI=1S/C21H25FO6S3/c1-3-5-16-17-14-15(6-7-18(17)28-21(29)20(16)22)30-11-8-26-9-12-31(24,25)13-10-27-19(23)4-2/h4,6-7,14H,2-3,5,8-13H2,1H3 |
| InChIKey | IZZZZBAKJQSDRW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|