C20H23F3O5S — CID 164597270
2-[2-[4-methyl-2-oxo-3-(2,2,2-trifluoroethyl)chromen-7-yl]sulfanylethoxy]ethyl 2-methylpropanoate (PubChem CID 164597270) has the molecular formula C20H23F3O5S and a molecular weight of 432.46 g/mol. Its IUPAC name is 2-[2-[4-methyl-2-oxo-3-(2,2,2-trifluoroethyl)chromen-7-yl]sulfanylethoxy]ethyl 2-methylpropanoate.
| Compound Name | 2-[2-[4-methyl-2-oxo-3-(2,2,2-trifluoroethyl)chromen-7-yl]sulfanylethoxy]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 164597270 |
| Molecular Formula | C20H23F3O5S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 2-[2-[4-methyl-2-oxo-3-(2,2,2-trifluoroethyl)chromen-7-yl]sulfanylethoxy]ethyl 2-methylpropanoate |
| SMILES | Cc1c(CC(F)(F)F)c(=O)oc2cc(SCCOCCOC(=O)C(C)C)ccc12 |
| InChI | InChI=1S/C20H23F3O5S/c1-12(2)18(24)27-7-6-26-8-9-29-14-4-5-15-13(3)16(11-20(21,22)23)19(25)28-17(15)10-14/h4-5,10,12H,6-9,11H2,1-3H3 |
| InChIKey | NPIGEERAXUDEDD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|