About butane;(E)-3-methylhex-3-en-5-yn-2-one;oct-1-en-3-imine
butane;(E)-3-methylhex-3-en-5-yn-2-one;oct-1-en-3-imine (PubChem CID 164597855) has the molecular formula C19H33NO
and a molecular weight of 291.48 g/mol. Its IUPAC name is butane;(E)-3-methylhex-3-en-5-yn-2-one;oct-1-en-3-imine.
Molecular Properties
| Compound Name | butane;(E)-3-methylhex-3-en-5-yn-2-one;oct-1-en-3-imine |
| PubChem CID | 164597855 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | butane;(E)-3-methylhex-3-en-5-yn-2-one;oct-1-en-3-imine |
| SMILES | C#C/C=C(\C)C(C)=O.CCCC.[H]/N=C(\C=C)CCCCC |
| InChI | InChI=1S/C8H15N.C7H8O.C4H10/c1-3-5-6-7-8(9)4-2;1-4-5-6(2)7(3)8;1-3-4-2/h4,9H,2-3,5-7H2,1H3;1,5H,2-3H3;3-4H2,1-2H3/b9-8+;6-5+; |
| InChIKey | CNYDTFIHUPWHQY-SNJOSCHPSA-N |
| XLogP | 5.73 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze butane;(E)-3-methylhex-3-en-5-yn-2-one;oct-1-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;(E)-3-methylhex-3-en-5-yn-2-one;oct-1-en-3-imine?
The IUPAC name of butane;(E)-3-methylhex-3-en-5-yn-2-one;oct-1-en-3-imine (CID 164597855) is butane;(E)-3-methylhex-3-en-5-yn-2-one;oct-1-en-3-imine.
What is the SMILES notation for butane;(E)-3-methylhex-3-en-5-yn-2-one;oct-1-en-3-imine?
The canonical SMILES for butane;(E)-3-methylhex-3-en-5-yn-2-one;oct-1-en-3-imine is C#C/C=C(\C)C(C)=O.CCCC.[H]/N=C(\C=C)CCCCC.
What is the InChIKey of butane;(E)-3-methylhex-3-en-5-yn-2-one;oct-1-en-3-imine?
The InChIKey is CNYDTFIHUPWHQY-SNJOSCHPSA-N. The full InChI is InChI=1S/C8H15N.C7H8O.C4H10/c1-3-5-6-7-8(9)4-2;1-4-5-6(2)7(3)8;1-3-4-2/h4,9H,2-3,5-7H2,1H3;1,5H,2-3H3;3-4H2,1-2H3/b9-8+;6-5+;.
What are the key properties of butane;(E)-3-methylhex-3-en-5-yn-2-one;oct-1-en-3-imine?
butane;(E)-3-methylhex-3-en-5-yn-2-one;oct-1-en-3-imine has a molecular weight of 291.48 g/mol, XLogP of 5.73, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;(E)-3-methylhex-3-en-5-yn-2-one;oct-1-en-3-imine is sourced from PubChem (CID 164597855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).