About spiro[benzo[c]chromene-6,3'-oxetane]-3-ol
spiro[benzo[c]chromene-6,3'-oxetane]-3-ol (PubChem CID 164598173) has the molecular formula C15H12O3
and a molecular weight of 240.26 g/mol. Its IUPAC name is spiro[benzo[c]chromene-6,3'-oxetane]-3-ol.
Molecular Properties
| Compound Name | spiro[benzo[c]chromene-6,3'-oxetane]-3-ol |
| PubChem CID | 164598173 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | spiro[benzo[c]chromene-6,3'-oxetane]-3-ol |
| SMILES | Oc1ccc2c(c1)OC1(COC1)c1ccccc1-2 |
| InChI | InChI=1S/C15H12O3/c16-10-5-6-12-11-3-1-2-4-13(11)15(8-17-9-15)18-14(12)7-10/h1-7,16H,8-9H2 |
| InChIKey | JRYXFHPAVQMSER-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[benzo[c]chromene-6,3'-oxetane]-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[benzo[c]chromene-6,3'-oxetane]-3-ol?
The IUPAC name of spiro[benzo[c]chromene-6,3'-oxetane]-3-ol (CID 164598173) is spiro[benzo[c]chromene-6,3'-oxetane]-3-ol.
What is the SMILES notation for spiro[benzo[c]chromene-6,3'-oxetane]-3-ol?
The canonical SMILES for spiro[benzo[c]chromene-6,3'-oxetane]-3-ol is Oc1ccc2c(c1)OC1(COC1)c1ccccc1-2.
What is the InChIKey of spiro[benzo[c]chromene-6,3'-oxetane]-3-ol?
The InChIKey is JRYXFHPAVQMSER-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O3/c16-10-5-6-12-11-3-1-2-4-13(11)15(8-17-9-15)18-14(12)7-10/h1-7,16H,8-9H2.
What are the key properties of spiro[benzo[c]chromene-6,3'-oxetane]-3-ol?
spiro[benzo[c]chromene-6,3'-oxetane]-3-ol has a molecular weight of 240.26 g/mol, XLogP of 2.68, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[benzo[c]chromene-6,3'-oxetane]-3-ol is sourced from PubChem (CID 164598173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).