About 5-cyclopropyl-3,8-dihydroxy-9-methylphenanthridin-6-one
5-cyclopropyl-3,8-dihydroxy-9-methylphenanthridin-6-one (PubChem CID 164598275) has the molecular formula C17H15NO3
and a molecular weight of 281.31 g/mol. Its IUPAC name is 5-cyclopropyl-3,8-dihydroxy-9-methylphenanthridin-6-one.
Molecular Properties
| Compound Name | 5-cyclopropyl-3,8-dihydroxy-9-methylphenanthridin-6-one |
| PubChem CID | 164598275 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 5-cyclopropyl-3,8-dihydroxy-9-methylphenanthridin-6-one |
| SMILES | Cc1cc2c(cc1O)c(=O)n(C1CC1)c1cc(O)ccc21 |
| InChI | InChI=1S/C17H15NO3/c1-9-6-13-12-5-4-11(19)7-15(12)18(10-2-3-10)17(21)14(13)8-16(9)20/h4-8,10,19-20H,2-3H2,1H3 |
| InChIKey | WESHAKKULNZJDI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclopropyl-3,8-dihydroxy-9-methylphenanthridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-3,8-dihydroxy-9-methylphenanthridin-6-one?
The IUPAC name of 5-cyclopropyl-3,8-dihydroxy-9-methylphenanthridin-6-one (CID 164598275) is 5-cyclopropyl-3,8-dihydroxy-9-methylphenanthridin-6-one.
What is the SMILES notation for 5-cyclopropyl-3,8-dihydroxy-9-methylphenanthridin-6-one?
The canonical SMILES for 5-cyclopropyl-3,8-dihydroxy-9-methylphenanthridin-6-one is Cc1cc2c(cc1O)c(=O)n(C1CC1)c1cc(O)ccc21.
What is the InChIKey of 5-cyclopropyl-3,8-dihydroxy-9-methylphenanthridin-6-one?
The InChIKey is WESHAKKULNZJDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO3/c1-9-6-13-12-5-4-11(19)7-15(12)18(10-2-3-10)17(21)14(13)8-16(9)20/h4-8,10,19-20H,2-3H2,1H3.
What are the key properties of 5-cyclopropyl-3,8-dihydroxy-9-methylphenanthridin-6-one?
5-cyclopropyl-3,8-dihydroxy-9-methylphenanthridin-6-one has a molecular weight of 281.31 g/mol, XLogP of 3.21, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-3,8-dihydroxy-9-methylphenanthridin-6-one is sourced from PubChem (CID 164598275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).