About 1-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]benzotriazole
1-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]benzotriazole (PubChem CID 164599753) has the molecular formula C13H11F2N5O2S
and a molecular weight of 339.33 g/mol. Its IUPAC name is 1-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]benzotriazole.
Molecular Properties
| Compound Name | 1-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]benzotriazole |
| PubChem CID | 164599753 |
| Molecular Formula | C13H11F2N5O2S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 1-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]benzotriazole |
| SMILES | NS(=O)(=O)NCc1cc(F)c(-n2nnc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C13H11F2N5O2S/c14-9-5-8(7-17-23(16,21)22)6-10(15)13(9)20-12-4-2-1-3-11(12)18-19-20/h1-6,17H,7H2,(H2,16,21,22) |
| InChIKey | OOHPBVFOAKWNHW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]benzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]benzotriazole?
The IUPAC name of 1-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]benzotriazole (CID 164599753) is 1-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]benzotriazole.
What is the SMILES notation for 1-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]benzotriazole?
The canonical SMILES for 1-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]benzotriazole is NS(=O)(=O)NCc1cc(F)c(-n2nnc3ccccc32)c(F)c1.
What is the InChIKey of 1-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]benzotriazole?
The InChIKey is OOHPBVFOAKWNHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F2N5O2S/c14-9-5-8(7-17-23(16,21)22)6-10(15)13(9)20-12-4-2-1-3-11(12)18-19-20/h1-6,17H,7H2,(H2,16,21,22).
What are the key properties of 1-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]benzotriazole?
1-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]benzotriazole has a molecular weight of 339.33 g/mol, XLogP of 0.99, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]benzotriazole is sourced from PubChem (CID 164599753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).