C13H11F3N4 — CID 164599917
3,3-dimethyl-11-(trifluoromethyl)-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carbonitrile (PubChem CID 164599917) has the molecular formula C13H11F3N4 and a molecular weight of 280.25 g/mol. Its IUPAC name is 3,3-dimethyl-11-(trifluoromethyl)-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carbonitrile.
| Compound Name | 3,3-dimethyl-11-(trifluoromethyl)-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carbonitrile |
|---|---|
| PubChem CID | 164599917 |
| Molecular Formula | C13H11F3N4 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3,3-dimethyl-11-(trifluoromethyl)-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carbonitrile |
| SMILES | CC1(C)CC(C#N)c2cnc3cc(C(F)(F)F)nn3c21 |
| InChI | InChI=1S/C13H11F3N4/c1-12(2)4-7(5-17)8-6-18-10-3-9(13(14,15)16)19-20(10)11(8)12/h3,6-7H,4H2,1-2H3 |
| InChIKey | RQJZPADNIZZBAB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |