C12H12FN3O — CID 164599923
11-fluoro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carbaldehyde (PubChem CID 164599923) has the molecular formula C12H12FN3O and a molecular weight of 233.25 g/mol. Its IUPAC name is 11-fluoro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carbaldehyde.
| Compound Name | 11-fluoro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carbaldehyde |
|---|---|
| PubChem CID | 164599923 |
| Molecular Formula | C12H12FN3O |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 11-fluoro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carbaldehyde |
| SMILES | CC1(C)CC(C=O)c2cnc3cc(F)nn3c21 |
| InChI | InChI=1S/C12H12FN3O/c1-12(2)4-7(6-17)8-5-14-10-3-9(13)15-16(10)11(8)12/h3,5-7H,4H2,1-2H3 |
| InChIKey | GZSDWIXEYLOTNS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|