C12H12FN3 — CID 164599933
11-fluorospiro[1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3,1'-cyclobutane] (PubChem CID 164599933) has the molecular formula C12H12FN3 and a molecular weight of 217.25 g/mol. Its IUPAC name is 11-fluorospiro[1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3,1'-cyclobutane].
| Compound Name | 11-fluorospiro[1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3,1'-cyclobutane] |
|---|---|
| PubChem CID | 164599933 |
| Molecular Formula | C12H12FN3 |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 11-fluorospiro[1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3,1'-cyclobutane] |
| SMILES | Fc1cc2ncc3c(n2n1)C1(CCC1)CC3 |
| InChI | InChI=1S/C12H12FN3/c13-9-6-10-14-7-8-2-5-12(3-1-4-12)11(8)16(10)15-9/h6-7H,1-5H2 |
| InChIKey | HCPMMMINKLUSDY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |