C30H28F3N7O2 — CID 164600020
N-[(1E,3Z)-1,4-diamino-3-(benzhydrylideneamino)-4-(difluoromethoxy)buta-1,3-dienyl]-11-fluoro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide (PubChem CID 164600020) has the molecular formula C30H28F3N7O2 and a molecular weight of 575.60 g/mol. Its IUPAC name is N-[(1E,3Z)-1,4-diamino-3-(benzhydrylideneamino)-4-(difluoromethoxy)buta-1,3-dienyl]-11-fluoro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide.
| Compound Name | N-[(1E,3Z)-1,4-diamino-3-(benzhydrylideneamino)-4-(difluoromethoxy)buta-1,3-dienyl]-11-fluoro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 164600020 |
| Molecular Formula | C30H28F3N7O2 |
| Molecular Weight | 575.60 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | N-[(1E,3Z)-1,4-diamino-3-(benzhydrylideneamino)-4-(difluoromethoxy)buta-1,3-dienyl]-11-fluoro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
| SMILES | CC1(C)CC(C(=O)N/C(N)=C/C(N=C(c2ccccc2)c2ccccc2)=C(\N)OC(F)F)c2cnc3cc(F)nn3c21 |
| InChI | InChI=1S/C30H28F3N7O2/c1-30(2)15-19(20-16-36-24-14-22(31)39-40(24)26(20)30)28(41)38-23(34)13-21(27(35)42-29(32)33)37-25(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-14,16,19,29H,15,34-35H2,1-2H3,(H,38,41)/b23-13+,27-21- |
| InChIKey | LYLPEUJKMSGQEW-MOXFAGKRSA-N |
| XLogP | 4.45 |
| TPSA | 132.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|