C14H14FN3O3 — CID 164600063
11-fluorospiro[1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3,4'-oxane]-5-carboxylic acid (PubChem CID 164600063) has the molecular formula C14H14FN3O3 and a molecular weight of 291.28 g/mol. Its IUPAC name is 11-fluorospiro[1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3,4'-oxane]-5-carboxylic acid.
| Compound Name | 11-fluorospiro[1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3,4'-oxane]-5-carboxylic acid |
|---|---|
| PubChem CID | 164600063 |
| Molecular Formula | C14H14FN3O3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 11-fluorospiro[1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3,4'-oxane]-5-carboxylic acid |
| SMILES | O=C(O)C1CC2(CCOCC2)c2c1cnc1cc(F)nn21 |
| InChI | InChI=1S/C14H14FN3O3/c15-10-5-11-16-7-9-8(13(19)20)6-14(1-3-21-4-2-14)12(9)18(11)17-10/h5,7-8H,1-4,6H2,(H,19,20) |
| InChIKey | SSUWMYHFZLKNJU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |