C12H14FN3 — CID 164600076
11-fluoro-3,3,5-trimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene (PubChem CID 164600076) has the molecular formula C12H14FN3 and a molecular weight of 219.26 g/mol. Its IUPAC name is 11-fluoro-3,3,5-trimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene.
| Compound Name | 11-fluoro-3,3,5-trimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
|---|---|
| PubChem CID | 164600076 |
| Molecular Formula | C12H14FN3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 11-fluoro-3,3,5-trimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
| SMILES | CC1CC(C)(C)c2c1cnc1cc(F)nn21 |
| InChI | InChI=1S/C12H14FN3/c1-7-5-12(2,3)11-8(7)6-14-10-4-9(13)15-16(10)11/h4,6-7H,5H2,1-3H3 |
| InChIKey | SNBCAWMIJHXDEN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |