C13H15F2N3 — CID 164600080
(10S)-4-(difluoromethyl)-10,12,12-trimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene (PubChem CID 164600080) has the molecular formula C13H15F2N3 and a molecular weight of 251.28 g/mol. Its IUPAC name is (10S)-4-(difluoromethyl)-10,12,12-trimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene.
| Compound Name | (10S)-4-(difluoromethyl)-10,12,12-trimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene |
|---|---|
| PubChem CID | 164600080 |
| Molecular Formula | C13H15F2N3 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (10S)-4-(difluoromethyl)-10,12,12-trimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene |
| SMILES | C[C@H]1CC(C)(C)c2c1cnn1cc(C(F)F)nc21 |
| InChI | InChI=1S/C13H15F2N3/c1-7-4-13(2,3)10-8(7)5-16-18-6-9(11(14)15)17-12(10)18/h5-7,11H,4H2,1-3H3/t7-/m0/s1 |
| InChIKey | YHXIVEJXXAYPOX-ZETCQYMHSA-N |
| XLogP | 3.45 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |