C23H23ClF2N6O3 — CID 164600185
11-chloro-N-[4-(difluoromethyl)-5-[(E)-3-(dimethylamino)prop-2-enoyl]-6-oxo-1H-pyridin-2-yl]-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide (PubChem CID 164600185) has the molecular formula C23H23ClF2N6O3 and a molecular weight of 504.93 g/mol. Its IUPAC name is 11-chloro-N-[4-(difluoromethyl)-5-[(E)-3-(dimethylamino)prop-2-enoyl]-6-oxo-1H-pyridin-2-yl]-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide.
| Compound Name | 11-chloro-N-[4-(difluoromethyl)-5-[(E)-3-(dimethylamino)prop-2-enoyl]-6-oxo-1H-pyridin-2-yl]-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 164600185 |
| Molecular Formula | C23H23ClF2N6O3 |
| Molecular Weight | 504.93 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 11-chloro-N-[4-(difluoromethyl)-5-[(E)-3-(dimethylamino)prop-2-enoyl]-6-oxo-1H-pyridin-2-yl]-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
| SMILES | CN(C)/C=C/C(=O)c1c(C(F)F)cc(NC(=O)C2CC(C)(C)c3c2cnc2cc(Cl)nn32)[nH]c1=O |
| InChI | InChI=1S/C23H23ClF2N6O3/c1-23(2)9-12(13-10-27-17-8-15(24)30-32(17)19(13)23)21(34)28-16-7-11(20(25)26)18(22(35)29-16)14(33)5-6-31(3)4/h5-8,10,12,20H,9H2,1-4H3,(H2,28,29,34,35)/b6-5+ |
| InChIKey | MNGMKKCXKKJLRG-AATRIKPKSA-N |
| XLogP | 3.67 |
| TPSA | 112.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.93 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|