C17H27N3O2 — CID 164600284
ethane;4,12,12-trimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carboxylic acid (PubChem CID 164600284) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is ethane;4,12,12-trimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carboxylic acid.
| Compound Name | ethane;4,12,12-trimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carboxylic acid |
|---|---|
| PubChem CID | 164600284 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | ethane;4,12,12-trimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carboxylic acid |
| SMILES | CC.CC.Cc1cn2ncc3c(c2n1)C(C)(C)CC3C(=O)O |
| InChI | InChI=1S/C13H15N3O2.2C2H6/c1-7-6-16-11(15-7)10-9(5-14-16)8(12(17)18)4-13(10,2)3;2*1-2/h5-6,8H,4H2,1-3H3,(H,17,18);2*1-2H3 |
| InChIKey | YAVAJMCRRWULHC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |