C20H19ClN8O — CID 164600306
(5R)-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3,3,11-trimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide (PubChem CID 164600306) has the molecular formula C20H19ClN8O and a molecular weight of 422.88 g/mol. Its IUPAC name is (5R)-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3,3,11-trimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide.
| Compound Name | (5R)-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3,3,11-trimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 164600306 |
| Molecular Formula | C20H19ClN8O |
| Molecular Weight | 422.88 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (5R)-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3,3,11-trimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
| SMILES | Cc1cc2ncc3c(n2n1)C(C)(C)C[C@H]3C(=O)Nc1cnc(-n2nccn2)c(Cl)c1 |
| InChI | InChI=1S/C20H19ClN8O/c1-11-6-16-22-10-14-13(8-20(2,3)17(14)28(16)27-11)19(30)26-12-7-15(21)18(23-9-12)29-24-4-5-25-29/h4-7,9-10,13H,8H2,1-3H3,(H,26,30)/t13-/m1/s1 |
| InChIKey | BLBLHMXYSGNEEZ-CYBMUJFWSA-N |
| XLogP | 3.07 |
| TPSA | 102.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.88 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |