C13H13F2N3O — CID 164600411
(10S)-4-(difluoromethyl)-12,12-dimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carbaldehyde (PubChem CID 164600411) has the molecular formula C13H13F2N3O and a molecular weight of 265.26 g/mol. Its IUPAC name is (10S)-4-(difluoromethyl)-12,12-dimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carbaldehyde.
| Compound Name | (10S)-4-(difluoromethyl)-12,12-dimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carbaldehyde |
|---|---|
| PubChem CID | 164600411 |
| Molecular Formula | C13H13F2N3O |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (10S)-4-(difluoromethyl)-12,12-dimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carbaldehyde |
| SMILES | CC1(C)C[C@H](C=O)c2cnn3cc(C(F)F)nc3c21 |
| InChI | InChI=1S/C13H13F2N3O/c1-13(2)3-7(6-19)8-4-16-18-5-9(11(14)15)17-12(18)10(8)13/h4-7,11H,3H2,1-2H3/t7-/m1/s1 |
| InChIKey | AXKPJXFYNMDKJT-SSDOTTSWSA-N |
| XLogP | 2.63 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|