C13H14FN3O2 — CID 164600505
11-fluoro-3,3,10-trimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylic acid (PubChem CID 164600505) has the molecular formula C13H14FN3O2 and a molecular weight of 263.27 g/mol. Its IUPAC name is 11-fluoro-3,3,10-trimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylic acid.
| Compound Name | 11-fluoro-3,3,10-trimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylic acid |
|---|---|
| PubChem CID | 164600505 |
| Molecular Formula | C13H14FN3O2 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 11-fluoro-3,3,10-trimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylic acid |
| SMILES | Cc1c(F)nn2c3c(cnc12)C(C(=O)O)CC3(C)C |
| InChI | InChI=1S/C13H14FN3O2/c1-6-10(14)16-17-9-8(5-15-11(6)17)7(12(18)19)4-13(9,2)3/h5,7H,4H2,1-3H3,(H,18,19) |
| InChIKey | PRBJMAJUHZTTDI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |