C14H15F2N3O2 — CID 164600620
methyl 4-(difluoromethyl)-12,12-dimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carboxylate (PubChem CID 164600620) has the molecular formula C14H15F2N3O2 and a molecular weight of 295.29 g/mol. Its IUPAC name is methyl 4-(difluoromethyl)-12,12-dimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carboxylate.
| Compound Name | methyl 4-(difluoromethyl)-12,12-dimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 164600620 |
| Molecular Formula | C14H15F2N3O2 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | methyl 4-(difluoromethyl)-12,12-dimethyl-3,6,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraene-10-carboxylate |
| SMILES | COC(=O)C1CC(C)(C)c2c1cnn1cc(C(F)F)nc21 |
| InChI | InChI=1S/C14H15F2N3O2/c1-14(2)4-7(13(20)21-3)8-5-17-19-6-9(11(15)16)18-12(19)10(8)14/h5-7,11H,4H2,1-3H3 |
| InChIKey | BRPGGMBFGVHHFE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |