C32H31Cl2FN3O4Si — CID 164602026
CID 164602026 (PubChem CID 164602026) has the molecular formula C32H31Cl2FN3O4Si and a molecular weight of 639.61 g/mol.
| Compound Name | CID 164602026 |
|---|---|
| PubChem CID | 164602026 |
| Molecular Formula | C32H31Cl2FN3O4Si |
| Molecular Weight | 639.61 g/mol |
| Exact Mass | 638.14 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccc2nc(CN3CCC(Cc4ccc(F)c(COc5ccc(Cl)cc5Cl)c4)CC3)n(C[C@]3([Si])CCO3)c2c1 |
| InChI | InChI=1S/C32H31Cl2FN3O4Si/c33-24-3-6-29(25(34)16-24)41-18-23-14-21(1-4-26(23)35)13-20-7-10-37(11-8-20)17-30-36-27-5-2-22(31(39)40)15-28(27)38(30)19-32(43)9-12-42-32/h1-6,14-16,20H,7-13,17-19H2,(H,39,40)/t32-/m1/s1 |
| InChIKey | DBDNTVZILAOCOO-JGCGQSQUSA-N |
| XLogP | 6.50 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.61 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|