About ethane;(2-methoxy-1,2-dihydropyridin-4-yl)methanol
ethane;(2-methoxy-1,2-dihydropyridin-4-yl)methanol (PubChem CID 164602647) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is ethane;(2-methoxy-1,2-dihydropyridin-4-yl)methanol.
Molecular Properties
| Compound Name | ethane;(2-methoxy-1,2-dihydropyridin-4-yl)methanol |
| PubChem CID | 164602647 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | ethane;(2-methoxy-1,2-dihydropyridin-4-yl)methanol |
| SMILES | CC.COC1C=C(CO)C=CN1 |
| InChI | InChI=1S/C7H11NO2.C2H6/c1-10-7-4-6(5-9)2-3-8-7;1-2/h2-4,7-9H,5H2,1H3;1-2H3 |
| InChIKey | DXDZDLDQKCIGHL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;(2-methoxy-1,2-dihydropyridin-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2-methoxy-1,2-dihydropyridin-4-yl)methanol?
The IUPAC name of ethane;(2-methoxy-1,2-dihydropyridin-4-yl)methanol (CID 164602647) is ethane;(2-methoxy-1,2-dihydropyridin-4-yl)methanol.
What is the SMILES notation for ethane;(2-methoxy-1,2-dihydropyridin-4-yl)methanol?
The canonical SMILES for ethane;(2-methoxy-1,2-dihydropyridin-4-yl)methanol is CC.COC1C=C(CO)C=CN1.
What is the InChIKey of ethane;(2-methoxy-1,2-dihydropyridin-4-yl)methanol?
The InChIKey is DXDZDLDQKCIGHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2.C2H6/c1-10-7-4-6(5-9)2-3-8-7;1-2/h2-4,7-9H,5H2,1H3;1-2H3.
What are the key properties of ethane;(2-methoxy-1,2-dihydropyridin-4-yl)methanol?
ethane;(2-methoxy-1,2-dihydropyridin-4-yl)methanol has a molecular weight of 171.24 g/mol, XLogP of 1.02, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2-methoxy-1,2-dihydropyridin-4-yl)methanol is sourced from PubChem (CID 164602647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).