About ethane;2-methoxy-1,2-dihydropyridine-4-carboxylic acid
ethane;2-methoxy-1,2-dihydropyridine-4-carboxylic acid (PubChem CID 164602745) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is ethane;2-methoxy-1,2-dihydropyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | ethane;2-methoxy-1,2-dihydropyridine-4-carboxylic acid |
| PubChem CID | 164602745 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | ethane;2-methoxy-1,2-dihydropyridine-4-carboxylic acid |
| SMILES | CC.COC1C=C(C(=O)O)C=CN1 |
| InChI | InChI=1S/C7H9NO3.C2H6/c1-11-6-4-5(7(9)10)2-3-8-6;1-2/h2-4,6,8H,1H3,(H,9,10);1-2H3 |
| InChIKey | BMTDQKVNSXEQMI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methoxy-1,2-dihydropyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methoxy-1,2-dihydropyridine-4-carboxylic acid?
The IUPAC name of ethane;2-methoxy-1,2-dihydropyridine-4-carboxylic acid (CID 164602745) is ethane;2-methoxy-1,2-dihydropyridine-4-carboxylic acid.
What is the SMILES notation for ethane;2-methoxy-1,2-dihydropyridine-4-carboxylic acid?
The canonical SMILES for ethane;2-methoxy-1,2-dihydropyridine-4-carboxylic acid is CC.COC1C=C(C(=O)O)C=CN1.
What is the InChIKey of ethane;2-methoxy-1,2-dihydropyridine-4-carboxylic acid?
The InChIKey is BMTDQKVNSXEQMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3.C2H6/c1-11-6-4-5(7(9)10)2-3-8-6;1-2/h2-4,6,8H,1H3,(H,9,10);1-2H3.
What are the key properties of ethane;2-methoxy-1,2-dihydropyridine-4-carboxylic acid?
ethane;2-methoxy-1,2-dihydropyridine-4-carboxylic acid has a molecular weight of 185.22 g/mol, XLogP of 1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methoxy-1,2-dihydropyridine-4-carboxylic acid is sourced from PubChem (CID 164602745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).