About 2-methoxy-1,2-dihydropyridine-4-carboxylic acid
2-methoxy-1,2-dihydropyridine-4-carboxylic acid (PubChem CID 164602746) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is 2-methoxy-1,2-dihydropyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-methoxy-1,2-dihydropyridine-4-carboxylic acid |
| PubChem CID | 164602746 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 2-methoxy-1,2-dihydropyridine-4-carboxylic acid |
| SMILES | COC1C=C(C(=O)O)C=CN1 |
| InChI | InChI=1S/C7H9NO3/c1-11-6-4-5(7(9)10)2-3-8-6/h2-4,6,8H,1H3,(H,9,10) |
| InChIKey | WKCXHBYPWDQFMR-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-1,2-dihydropyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1,2-dihydropyridine-4-carboxylic acid?
The IUPAC name of 2-methoxy-1,2-dihydropyridine-4-carboxylic acid (CID 164602746) is 2-methoxy-1,2-dihydropyridine-4-carboxylic acid.
What is the SMILES notation for 2-methoxy-1,2-dihydropyridine-4-carboxylic acid?
The canonical SMILES for 2-methoxy-1,2-dihydropyridine-4-carboxylic acid is COC1C=C(C(=O)O)C=CN1.
What is the InChIKey of 2-methoxy-1,2-dihydropyridine-4-carboxylic acid?
The InChIKey is WKCXHBYPWDQFMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c1-11-6-4-5(7(9)10)2-3-8-6/h2-4,6,8H,1H3,(H,9,10).
What are the key properties of 2-methoxy-1,2-dihydropyridine-4-carboxylic acid?
2-methoxy-1,2-dihydropyridine-4-carboxylic acid has a molecular weight of 155.15 g/mol, XLogP of 0.09, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1,2-dihydropyridine-4-carboxylic acid is sourced from PubChem (CID 164602746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).