About 1-[N'-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamimidoyl]-2-ethylguanidine
1-[N'-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamimidoyl]-2-ethylguanidine (PubChem CID 164603199) has the molecular formula C12H21N5
and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-[N'-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamimidoyl]-2-ethylguanidine.
Molecular Properties
| Compound Name | 1-[N'-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamimidoyl]-2-ethylguanidine |
| PubChem CID | 164603199 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 1-[N'-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamimidoyl]-2-ethylguanidine |
| SMILES | C=C/C=C(\C=C)CC/N=C(\N)N/C(N)=N/CC |
| InChI | InChI=1S/C12H21N5/c1-4-7-10(5-2)8-9-16-12(14)17-11(13)15-6-3/h4-5,7H,1-2,6,8-9H2,3H3,(H5,13,14,15,16,17)/b10-7+ |
| InChIKey | QPMCMUHSHCOTAK-JXMROGBWSA-N |
| XLogP | 0.91 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[N'-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamimidoyl]-2-ethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[N'-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamimidoyl]-2-ethylguanidine?
The IUPAC name of 1-[N'-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamimidoyl]-2-ethylguanidine (CID 164603199) is 1-[N'-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamimidoyl]-2-ethylguanidine.
What is the SMILES notation for 1-[N'-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamimidoyl]-2-ethylguanidine?
The canonical SMILES for 1-[N'-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamimidoyl]-2-ethylguanidine is C=C/C=C(\C=C)CC/N=C(\N)N/C(N)=N/CC.
What is the InChIKey of 1-[N'-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamimidoyl]-2-ethylguanidine?
The InChIKey is QPMCMUHSHCOTAK-JXMROGBWSA-N. The full InChI is InChI=1S/C12H21N5/c1-4-7-10(5-2)8-9-16-12(14)17-11(13)15-6-3/h4-5,7H,1-2,6,8-9H2,3H3,(H5,13,14,15,16,17)/b10-7+.
What are the key properties of 1-[N'-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamimidoyl]-2-ethylguanidine?
1-[N'-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamimidoyl]-2-ethylguanidine has a molecular weight of 235.33 g/mol, XLogP of 0.91, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[N'-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamimidoyl]-2-ethylguanidine is sourced from PubChem (CID 164603199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).