C14H23N — CID 164603215
azetidine;(1S)-1,5-dimethyl-2,3,4,5-tetrahydro-1H-indene (PubChem CID 164603215) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is azetidine;(1S)-1,5-dimethyl-2,3,4,5-tetrahydro-1H-indene.
| Compound Name | azetidine;(1S)-1,5-dimethyl-2,3,4,5-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 164603215 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | azetidine;(1S)-1,5-dimethyl-2,3,4,5-tetrahydro-1H-indene |
| SMILES | C1CNC1.CC1C=CC2=C(CC[C@@H]2C)C1 |
| InChI | InChI=1S/C11H16.C3H7N/c1-8-3-6-11-9(2)4-5-10(11)7-8;1-2-4-3-1/h3,6,8-9H,4-5,7H2,1-2H3;4H,1-3H2/t8?,9-;/m0./s1 |
| InChIKey | QXNUHHJMVUAEAT-MTFPJWTKSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |