About 6-ethenyl-5-(1-fluoroethenyl)-3,4-dihydro-2H-pyran-3-ol
6-ethenyl-5-(1-fluoroethenyl)-3,4-dihydro-2H-pyran-3-ol (PubChem CID 164603367) has the molecular formula C9H11FO2
and a molecular weight of 170.18 g/mol. Its IUPAC name is 6-ethenyl-5-(1-fluoroethenyl)-3,4-dihydro-2H-pyran-3-ol.
Molecular Properties
| Compound Name | 6-ethenyl-5-(1-fluoroethenyl)-3,4-dihydro-2H-pyran-3-ol |
| PubChem CID | 164603367 |
| Molecular Formula | C9H11FO2 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 6-ethenyl-5-(1-fluoroethenyl)-3,4-dihydro-2H-pyran-3-ol |
| SMILES | C=CC1=C(C(=C)F)CC(O)CO1 |
| InChI | InChI=1S/C9H11FO2/c1-3-9-8(6(2)10)4-7(11)5-12-9/h3,7,11H,1-2,4-5H2 |
| InChIKey | RWMUTVZMFQATLP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethenyl-5-(1-fluoroethenyl)-3,4-dihydro-2H-pyran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-5-(1-fluoroethenyl)-3,4-dihydro-2H-pyran-3-ol?
The IUPAC name of 6-ethenyl-5-(1-fluoroethenyl)-3,4-dihydro-2H-pyran-3-ol (CID 164603367) is 6-ethenyl-5-(1-fluoroethenyl)-3,4-dihydro-2H-pyran-3-ol.
What is the SMILES notation for 6-ethenyl-5-(1-fluoroethenyl)-3,4-dihydro-2H-pyran-3-ol?
The canonical SMILES for 6-ethenyl-5-(1-fluoroethenyl)-3,4-dihydro-2H-pyran-3-ol is C=CC1=C(C(=C)F)CC(O)CO1.
What is the InChIKey of 6-ethenyl-5-(1-fluoroethenyl)-3,4-dihydro-2H-pyran-3-ol?
The InChIKey is RWMUTVZMFQATLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FO2/c1-3-9-8(6(2)10)4-7(11)5-12-9/h3,7,11H,1-2,4-5H2.
What are the key properties of 6-ethenyl-5-(1-fluoroethenyl)-3,4-dihydro-2H-pyran-3-ol?
6-ethenyl-5-(1-fluoroethenyl)-3,4-dihydro-2H-pyran-3-ol has a molecular weight of 170.18 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-5-(1-fluoroethenyl)-3,4-dihydro-2H-pyran-3-ol is sourced from PubChem (CID 164603367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).