C10H7BrF2O2 — CID 164603577
(2R)-8-bromo-5,6-difluoro-2-methyl-2,3-dihydrochromen-4-one (PubChem CID 164603577) has the molecular formula C10H7BrF2O2 and a molecular weight of 277.06 g/mol. Its IUPAC name is (2R)-8-bromo-5,6-difluoro-2-methyl-2,3-dihydrochromen-4-one.
| Compound Name | (2R)-8-bromo-5,6-difluoro-2-methyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 164603577 |
| Molecular Formula | C10H7BrF2O2 |
| Molecular Weight | 277.06 g/mol |
| Exact Mass | 275.96 |
| IUPAC Name | (2R)-8-bromo-5,6-difluoro-2-methyl-2,3-dihydrochromen-4-one |
| SMILES | C[C@@H]1CC(=O)c2c(F)c(F)cc(Br)c2O1 |
| InChI | InChI=1S/C10H7BrF2O2/c1-4-2-7(14)8-9(13)6(12)3-5(11)10(8)15-4/h3-4H,2H2,1H3/t4-/m1/s1 |
| InChIKey | NVLUINUCJAMGDK-SCSAIBSYSA-N |
| XLogP | 3.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.06 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|