C15H21ClN2O2 — CID 164603608
2-chloro-N-(3-methylphenyl)acetamide;N-cyclopentylformamide (PubChem CID 164603608) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 2-chloro-N-(3-methylphenyl)acetamide;N-cyclopentylformamide.
| Compound Name | 2-chloro-N-(3-methylphenyl)acetamide;N-cyclopentylformamide |
|---|---|
| PubChem CID | 164603608 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-chloro-N-(3-methylphenyl)acetamide;N-cyclopentylformamide |
| SMILES | Cc1cccc(NC(=O)CCl)c1.O=CNC1CCCC1 |
| InChI | InChI=1S/C9H10ClNO.C6H11NO/c1-7-3-2-4-8(5-7)11-9(12)6-10;8-5-7-6-3-1-2-4-6/h2-5H,6H2,1H3,(H,11,12);5-6H,1-4H2,(H,7,8) |
| InChIKey | AUAVDJWBOPUTMT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|