C19H28FNO2 — CID 164603668
3-amino-1-[4-fluoro-3-[(2,6,6-trimethylcyclohexen-1-yl)methoxy]phenyl]propan-1-ol (PubChem CID 164603668) has the molecular formula C19H28FNO2 and a molecular weight of 321.44 g/mol. Its IUPAC name is 3-amino-1-[4-fluoro-3-[(2,6,6-trimethylcyclohexen-1-yl)methoxy]phenyl]propan-1-ol.
| Compound Name | 3-amino-1-[4-fluoro-3-[(2,6,6-trimethylcyclohexen-1-yl)methoxy]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 164603668 |
| Molecular Formula | C19H28FNO2 |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 3-amino-1-[4-fluoro-3-[(2,6,6-trimethylcyclohexen-1-yl)methoxy]phenyl]propan-1-ol |
| SMILES | CC1=C(COc2cc(C(O)CCN)ccc2F)C(C)(C)CCC1 |
| InChI | InChI=1S/C19H28FNO2/c1-13-5-4-9-19(2,3)15(13)12-23-18-11-14(6-7-16(18)20)17(22)8-10-21/h6-7,11,17,22H,4-5,8-10,12,21H2,1-3H3 |
| InChIKey | UMDAHPNHHRWGHF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|