About 7,8-dihydroxy-3-[1-(3-methylphenyl)pyrazol-4-yl]-2-(trifluoromethyl)chromen-4-one;ethane
7,8-dihydroxy-3-[1-(3-methylphenyl)pyrazol-4-yl]-2-(trifluoromethyl)chromen-4-one;ethane (PubChem CID 164603707) has the molecular formula C22H19F3N2O4
and a molecular weight of 432.40 g/mol. Its IUPAC name is 7,8-dihydroxy-3-[1-(3-methylphenyl)pyrazol-4-yl]-2-(trifluoromethyl)chromen-4-one;ethane.
Molecular Properties
| Compound Name | 7,8-dihydroxy-3-[1-(3-methylphenyl)pyrazol-4-yl]-2-(trifluoromethyl)chromen-4-one;ethane |
| PubChem CID | 164603707 |
| Molecular Formula | C22H19F3N2O4 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 7,8-dihydroxy-3-[1-(3-methylphenyl)pyrazol-4-yl]-2-(trifluoromethyl)chromen-4-one;ethane |
| SMILES | CC.Cc1cccc(-n2cc(-c3c(C(F)(F)F)oc4c(O)c(O)ccc4c3=O)cn2)c1 |
| InChI | InChI=1S/C20H13F3N2O4.C2H6/c1-10-3-2-4-12(7-10)25-9-11(8-24-25)15-16(27)13-5-6-14(26)17(28)18(13)29-19(15)20(21,22)23;1-2/h2-9,26,28H,1H3;1-2H3 |
| InChIKey | PGRSBUHIZFIJNG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 7,8-dihydroxy-3-[1-(3-methylphenyl)pyrazol-4-yl]-2-(trifluoromethyl)chromen-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydroxy-3-[1-(3-methylphenyl)pyrazol-4-yl]-2-(trifluoromethyl)chromen-4-one;ethane?
The IUPAC name of 7,8-dihydroxy-3-[1-(3-methylphenyl)pyrazol-4-yl]-2-(trifluoromethyl)chromen-4-one;ethane (CID 164603707) is 7,8-dihydroxy-3-[1-(3-methylphenyl)pyrazol-4-yl]-2-(trifluoromethyl)chromen-4-one;ethane.
What is the SMILES notation for 7,8-dihydroxy-3-[1-(3-methylphenyl)pyrazol-4-yl]-2-(trifluoromethyl)chromen-4-one;ethane?
The canonical SMILES for 7,8-dihydroxy-3-[1-(3-methylphenyl)pyrazol-4-yl]-2-(trifluoromethyl)chromen-4-one;ethane is CC.Cc1cccc(-n2cc(-c3c(C(F)(F)F)oc4c(O)c(O)ccc4c3=O)cn2)c1.
What is the InChIKey of 7,8-dihydroxy-3-[1-(3-methylphenyl)pyrazol-4-yl]-2-(trifluoromethyl)chromen-4-one;ethane?
The InChIKey is PGRSBUHIZFIJNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F3N2O4.C2H6/c1-10-3-2-4-12(7-10)25-9-11(8-24-25)15-16(27)13-5-6-14(26)17(28)18(13)29-19(15)20(21,22)23;1-2/h2-9,26,28H,1H3;1-2H3.
What are the key properties of 7,8-dihydroxy-3-[1-(3-methylphenyl)pyrazol-4-yl]-2-(trifluoromethyl)chromen-4-one;ethane?
7,8-dihydroxy-3-[1-(3-methylphenyl)pyrazol-4-yl]-2-(trifluoromethyl)chromen-4-one;ethane has a molecular weight of 432.40 g/mol, XLogP of 5.41, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydroxy-3-[1-(3-methylphenyl)pyrazol-4-yl]-2-(trifluoromethyl)chromen-4-one;ethane is sourced from PubChem (CID 164603707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).