C11H19F2NO2 — CID 164603912
1-[3-(difluoromethoxymethyl)piperidin-1-yl]-2-methylpropan-1-one (PubChem CID 164603912) has the molecular formula C11H19F2NO2 and a molecular weight of 235.27 g/mol. Its IUPAC name is 1-[3-(difluoromethoxymethyl)piperidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[3-(difluoromethoxymethyl)piperidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 164603912 |
| Molecular Formula | C11H19F2NO2 |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-[3-(difluoromethoxymethyl)piperidin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCCC(COC(F)F)C1 |
| InChI | InChI=1S/C11H19F2NO2/c1-8(2)10(15)14-5-3-4-9(6-14)7-16-11(12)13/h8-9,11H,3-7H2,1-2H3 |
| InChIKey | AKXSINNIPVUJRG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |