C33H37F3N6O5 — CID 164604269
(5R)-7-(1-benzylpyrazole-4-carbonyl)-N-[(2S,3R)-1-(methylamino)-1-oxo-3-phenylmethoxybutan-2-yl]-2-(3,3,3-trifluoropropanoyl)-2,7-diazaspiro[3.4]octane-5-carboxamide (PubChem CID 164604269) has the molecular formula C33H37F3N6O5 and a molecular weight of 654.69 g/mol. Its IUPAC name is (5R)-7-(1-benzylpyrazole-4-carbonyl)-N-[(2S,3R)-1-(methylamino)-1-oxo-3-phenylmethoxybutan-2-yl]-2-(3,3,3-trifluoropropanoyl)-2,7-diazaspiro[3.4]octane-5-carboxamide.
| Compound Name | (5R)-7-(1-benzylpyrazole-4-carbonyl)-N-[(2S,3R)-1-(methylamino)-1-oxo-3-phenylmethoxybutan-2-yl]-2-(3,3,3-trifluoropropanoyl)-2,7-diazaspiro[3.4]octane-5-carboxamide |
|---|---|
| PubChem CID | 164604269 |
| Molecular Formula | C33H37F3N6O5 |
| Molecular Weight | 654.69 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | (5R)-7-(1-benzylpyrazole-4-carbonyl)-N-[(2S,3R)-1-(methylamino)-1-oxo-3-phenylmethoxybutan-2-yl]-2-(3,3,3-trifluoropropanoyl)-2,7-diazaspiro[3.4]octane-5-carboxamide |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H]1CN(C(=O)c2cnn(Cc3ccccc3)c2)CC12CN(C(=O)CC(F)(F)F)C2)[C@@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C33H37F3N6O5/c1-22(47-18-24-11-7-4-8-12-24)28(30(45)37-2)39-29(44)26-17-40(19-32(26)20-41(21-32)27(43)13-33(34,35)36)31(46)25-14-38-42(16-25)15-23-9-5-3-6-10-23/h3-12,14,16,22,26,28H,13,15,17-21H2,1-2H3,(H,37,45)(H,39,44)/t22-,26-,28+/m1/s1 |
| InChIKey | NVEXEZQEPYSUQB-QIDLSXJSSA-N |
| XLogP | 2.62 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.69 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |