C9H13NO2 — CID 164604661
(4R)-4-[(3Z)-hexa-1,3,5-trien-2-yl]-1,3-oxazolidin-2-one;molecular hydrogen (PubChem CID 164604661) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is (4R)-4-[(3Z)-hexa-1,3,5-trien-2-yl]-1,3-oxazolidin-2-one;molecular hydrogen.
| Compound Name | (4R)-4-[(3Z)-hexa-1,3,5-trien-2-yl]-1,3-oxazolidin-2-one;molecular hydrogen |
|---|---|
| PubChem CID | 164604661 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | (4R)-4-[(3Z)-hexa-1,3,5-trien-2-yl]-1,3-oxazolidin-2-one;molecular hydrogen |
| SMILES | C=C/C=C\C(=C)[C@@H]1COC(=O)N1.[H][H] |
| InChI | InChI=1S/C9H11NO2.H2/c1-3-4-5-7(2)8-6-12-9(11)10-8;/h3-5,8H,1-2,6H2,(H,10,11);1H/b5-4-;/t8-;/m0./s1 |
| InChIKey | NRMGYRYXXOADHW-GWYRIBDWSA-N |
| XLogP | 1.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|