C9H11NO2 — CID 164604662
(4R)-4-[(3Z)-hexa-1,3,5-trien-2-yl]-1,3-oxazolidin-2-one (PubChem CID 164604662) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is (4R)-4-[(3Z)-hexa-1,3,5-trien-2-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-[(3Z)-hexa-1,3,5-trien-2-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 164604662 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (4R)-4-[(3Z)-hexa-1,3,5-trien-2-yl]-1,3-oxazolidin-2-one |
| SMILES | C=C/C=C\C(=C)[C@@H]1COC(=O)N1 |
| InChI | InChI=1S/C9H11NO2/c1-3-4-5-7(2)8-6-12-9(11)10-8/h3-5,8H,1-2,6H2,(H,10,11)/b5-4-/t8-/m0/s1 |
| InChIKey | FGHQPSJRMCOTSR-LGYSABEFSA-N |
| XLogP | 1.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|