About (4,4-difluorocyclohexyl)methanol;1-[4-(hydroxymethyl)piperidin-1-yl]butan-1-one
(4,4-difluorocyclohexyl)methanol;1-[4-(hydroxymethyl)piperidin-1-yl]butan-1-one (PubChem CID 164604891) has the molecular formula C17H31F2NO3
and a molecular weight of 335.44 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)methanol;1-[4-(hydroxymethyl)piperidin-1-yl]butan-1-one.
Molecular Properties
| Compound Name | (4,4-difluorocyclohexyl)methanol;1-[4-(hydroxymethyl)piperidin-1-yl]butan-1-one |
| PubChem CID | 164604891 |
| Molecular Formula | C17H31F2NO3 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | (4,4-difluorocyclohexyl)methanol;1-[4-(hydroxymethyl)piperidin-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCC(CO)CC1.OCC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H19NO2.C7H12F2O/c1-2-3-10(13)11-6-4-9(8-12)5-7-11;8-7(9)3-1-6(5-10)2-4-7/h9,12H,2-8H2,1H3;6,10H,1-5H2 |
| InChIKey | NLHQMPCVNKZFKY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4,4-difluorocyclohexyl)methanol;1-[4-(hydroxymethyl)piperidin-1-yl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluorocyclohexyl)methanol;1-[4-(hydroxymethyl)piperidin-1-yl]butan-1-one?
The IUPAC name of (4,4-difluorocyclohexyl)methanol;1-[4-(hydroxymethyl)piperidin-1-yl]butan-1-one (CID 164604891) is (4,4-difluorocyclohexyl)methanol;1-[4-(hydroxymethyl)piperidin-1-yl]butan-1-one.
What is the SMILES notation for (4,4-difluorocyclohexyl)methanol;1-[4-(hydroxymethyl)piperidin-1-yl]butan-1-one?
The canonical SMILES for (4,4-difluorocyclohexyl)methanol;1-[4-(hydroxymethyl)piperidin-1-yl]butan-1-one is CCCC(=O)N1CCC(CO)CC1.OCC1CCC(F)(F)CC1.
What is the InChIKey of (4,4-difluorocyclohexyl)methanol;1-[4-(hydroxymethyl)piperidin-1-yl]butan-1-one?
The InChIKey is NLHQMPCVNKZFKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2.C7H12F2O/c1-2-3-10(13)11-6-4-9(8-12)5-7-11;8-7(9)3-1-6(5-10)2-4-7/h9,12H,2-8H2,1H3;6,10H,1-5H2.
What are the key properties of (4,4-difluorocyclohexyl)methanol;1-[4-(hydroxymethyl)piperidin-1-yl]butan-1-one?
(4,4-difluorocyclohexyl)methanol;1-[4-(hydroxymethyl)piperidin-1-yl]butan-1-one has a molecular weight of 335.44 g/mol, XLogP of 2.82, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluorocyclohexyl)methanol;1-[4-(hydroxymethyl)piperidin-1-yl]butan-1-one is sourced from PubChem (CID 164604891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).