C16H32O5Si — CID 164606419
(4R,5R)-2,2-ditert-butyl-4-[(1R)-1-(methoxymethoxy)prop-2-enyl]-1,3,2-dioxasilinan-5-ol (PubChem CID 164606419) has the molecular formula C16H32O5Si and a molecular weight of 332.51 g/mol. Its IUPAC name is (4R,5R)-2,2-ditert-butyl-4-[(1R)-1-(methoxymethoxy)prop-2-enyl]-1,3,2-dioxasilinan-5-ol.
| Compound Name | (4R,5R)-2,2-ditert-butyl-4-[(1R)-1-(methoxymethoxy)prop-2-enyl]-1,3,2-dioxasilinan-5-ol |
|---|---|
| PubChem CID | 164606419 |
| Molecular Formula | C16H32O5Si |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (4R,5R)-2,2-ditert-butyl-4-[(1R)-1-(methoxymethoxy)prop-2-enyl]-1,3,2-dioxasilinan-5-ol |
| SMILES | C=C[C@@H](OCOC)[C@@H]1O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]1O |
| InChI | InChI=1S/C16H32O5Si/c1-9-13(19-11-18-8)14-12(17)10-20-22(21-14,15(2,3)4)16(5,6)7/h9,12-14,17H,1,10-11H2,2-8H3/t12-,13-,14-/m1/s1 |
| InChIKey | NWGHMYRUUQJJCI-MGPQQGTHSA-N |
| XLogP | 2.98 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|